C24H24N2O3 — CID 18357220
2-amino-N-(2,2-diphenylacetyl)-N-[(4-hydroxyphenyl)methyl]propanamide (PubChem CID 18357220) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-amino-N-(2,2-diphenylacetyl)-N-[(4-hydroxyphenyl)methyl]propanamide.
| Compound Name | 2-amino-N-(2,2-diphenylacetyl)-N-[(4-hydroxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 18357220 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-amino-N-(2,2-diphenylacetyl)-N-[(4-hydroxyphenyl)methyl]propanamide |
| SMILES | CC(N)C(=O)N(Cc1ccc(O)cc1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O3/c1-17(25)23(28)26(16-18-12-14-21(27)15-13-18)24(29)22(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,17,22,27H,16,25H2,1H3 |
| InChIKey | MHWVAZSXZDAKSV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |