C28H33N5O3 — CID 54226546
(2R)-5-[carbamimidoyl-(2,2-diphenylacetyl)amino]-2-[(4-hydroxyphenyl)methyl-methylamino]pentanamide (PubChem CID 54226546) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is (2R)-5-[carbamimidoyl-(2,2-diphenylacetyl)amino]-2-[(4-hydroxyphenyl)methyl-methylamino]pentanamide.
| Compound Name | (2R)-5-[carbamimidoyl-(2,2-diphenylacetyl)amino]-2-[(4-hydroxyphenyl)methyl-methylamino]pentanamide |
|---|---|
| PubChem CID | 54226546 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | (2R)-5-[carbamimidoyl-(2,2-diphenylacetyl)amino]-2-[(4-hydroxyphenyl)methyl-methylamino]pentanamide |
| SMILES | [H]/N=C(\N)N(CCC[C@H](C(N)=O)N(C)Cc1ccc(O)cc1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33N5O3/c1-32(19-20-14-16-23(34)17-15-20)24(26(29)35)13-8-18-33(28(30)31)27(36)25(21-9-4-2-5-10-21)22-11-6-3-7-12-22/h2-7,9-12,14-17,24-25,34H,8,13,18-19H2,1H3,(H2,29,35)(H3,30,31)/t24-/m1/s1 |
| InChIKey | QGGHPPGBNKMOFH-XMMPIXPASA-N |
| XLogP | 3.01 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|