C32H33N5O2 — CID 67571562
N-[(1R)-2-[benzyl(methyl)amino]-1-[3-[carbamimidoyl(methyl)amino]phenyl]-2-oxoethyl]-2,2-diphenylacetamide (PubChem CID 67571562) has the molecular formula C32H33N5O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is N-[(1R)-2-[benzyl(methyl)amino]-1-[3-[carbamimidoyl(methyl)amino]phenyl]-2-oxoethyl]-2,2-diphenylacetamide.
| Compound Name | N-[(1R)-2-[benzyl(methyl)amino]-1-[3-[carbamimidoyl(methyl)amino]phenyl]-2-oxoethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 67571562 |
| Molecular Formula | C32H33N5O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | N-[(1R)-2-[benzyl(methyl)amino]-1-[3-[carbamimidoyl(methyl)amino]phenyl]-2-oxoethyl]-2,2-diphenylacetamide |
| SMILES | [H]/N=C(\N)N(C)c1cccc([C@@H](NC(=O)C(c2ccccc2)c2ccccc2)C(=O)N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C32H33N5O2/c1-36(22-23-13-6-3-7-14-23)31(39)29(26-19-12-20-27(21-26)37(2)32(33)34)35-30(38)28(24-15-8-4-9-16-24)25-17-10-5-11-18-25/h3-21,28-29H,22H2,1-2H3,(H3,33,34)(H,35,38)/t29-/m1/s1 |
| InChIKey | DIPXCMQNXLBOAV-GDLZYMKVSA-N |
| XLogP | 4.66 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|