C39H39N7O4 — CID 67572316
N-[1-[3-(N-carbamimidoyl-4-methoxyanilino)phenyl]-2-[4-[(carbamoylamino)methyl]-N-methylanilino]-2-oxoethyl]-2,2-diphenylacetamide (PubChem CID 67572316) has the molecular formula C39H39N7O4 and a molecular weight of 669.79 g/mol. Its IUPAC name is N-[1-[3-(N-carbamimidoyl-4-methoxyanilino)phenyl]-2-[4-[(carbamoylamino)methyl]-N-methylanilino]-2-oxoethyl]-2,2-diphenylacetamide.
| Compound Name | N-[1-[3-(N-carbamimidoyl-4-methoxyanilino)phenyl]-2-[4-[(carbamoylamino)methyl]-N-methylanilino]-2-oxoethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 67572316 |
| Molecular Formula | C39H39N7O4 |
| Molecular Weight | 669.79 g/mol |
| Exact Mass | 669.31 |
| IUPAC Name | N-[1-[3-(N-carbamimidoyl-4-methoxyanilino)phenyl]-2-[4-[(carbamoylamino)methyl]-N-methylanilino]-2-oxoethyl]-2,2-diphenylacetamide |
| SMILES | [H]/N=C(\N)N(c1ccc(OC)cc1)c1cccc(C(NC(=O)C(c2ccccc2)c2ccccc2)C(=O)N(C)c2ccc(CNC(N)=O)cc2)c1 |
| InChI | InChI=1S/C39H39N7O4/c1-45(30-18-16-26(17-19-30)25-43-39(42)49)37(48)35(44-36(47)34(27-10-5-3-6-11-27)28-12-7-4-8-13-28)29-14-9-15-32(24-29)46(38(40)41)31-20-22-33(50-2)23-21-31/h3-24,34-35H,25H2,1-2H3,(H3,40,41)(H,44,47)(H3,42,43,49) |
| InChIKey | MKIXXEVKBAHCPZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 166.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.79 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|