C31H38N4O4 — CID 149431911
(2R)-5-[carbamimidoyl(ethyl)amino]-2-[(2,2-diphenylacetyl)-[(1R)-1-(4-methoxyphenyl)ethyl]amino]pentanoic acid (PubChem CID 149431911) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is (2R)-5-[carbamimidoyl(ethyl)amino]-2-[(2,2-diphenylacetyl)-[(1R)-1-(4-methoxyphenyl)ethyl]amino]pentanoic acid.
| Compound Name | (2R)-5-[carbamimidoyl(ethyl)amino]-2-[(2,2-diphenylacetyl)-[(1R)-1-(4-methoxyphenyl)ethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 149431911 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | (2R)-5-[carbamimidoyl(ethyl)amino]-2-[(2,2-diphenylacetyl)-[(1R)-1-(4-methoxyphenyl)ethyl]amino]pentanoic acid |
| SMILES | [H]/N=C(\N)N(CC)CCC[C@H](C(=O)O)N(C(=O)C(c1ccccc1)c1ccccc1)[C@H](C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H38N4O4/c1-4-34(31(32)33)21-11-16-27(30(37)38)35(22(2)23-17-19-26(39-3)20-18-23)29(36)28(24-12-7-5-8-13-24)25-14-9-6-10-15-25/h5-10,12-15,17-20,22,27-28H,4,11,16,21H2,1-3H3,(H3,32,33)(H,37,38)/t22-,27-/m1/s1 |
| InChIKey | ZAQGZPUVWDZRIA-AJTFRIOCSA-N |
| XLogP | 4.87 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|