C22H30N2O — CID 173345917
2-(4-methoxyphenyl)-5-phenylnonanimidamide (PubChem CID 173345917) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-phenylnonanimidamide.
| Compound Name | 2-(4-methoxyphenyl)-5-phenylnonanimidamide |
|---|---|
| PubChem CID | 173345917 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-phenylnonanimidamide |
| SMILES | [H]/N=C(\N)C(CCC(CCCC)c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H30N2O/c1-3-4-8-18(17-9-6-5-7-10-17)13-16-21(22(23)24)19-11-14-20(25-2)15-12-19/h5-7,9-12,14-15,18,21H,3-4,8,13,16H2,1-2H3,(H3,23,24) |
| InChIKey | YSKKSJAVCYLYFT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|