C15H25N3 — CID 64536672
3-[methyl(pentyl)amino]-2-phenylpropanimidamide (PubChem CID 64536672) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 3-[methyl(pentyl)amino]-2-phenylpropanimidamide.
| Compound Name | 3-[methyl(pentyl)amino]-2-phenylpropanimidamide |
|---|---|
| PubChem CID | 64536672 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 3-[methyl(pentyl)amino]-2-phenylpropanimidamide |
| SMILES | [H]/N=C(\N)C(CN(C)CCCCC)c1ccccc1 |
| InChI | InChI=1S/C15H25N3/c1-3-4-8-11-18(2)12-14(15(16)17)13-9-6-5-7-10-13/h5-7,9-10,14H,3-4,8,11-12H2,1-2H3,(H3,16,17) |
| InChIKey | WYCRSTVFHSSMMZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|