C45H47N5O7 — CID 57205788
benzyl N-[(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(1S)-1-(4-methoxyphenyl)ethyl]amino]pentanoyl]-N-phenylmethoxycarbonylcarbamate (PubChem CID 57205788) has the molecular formula C45H47N5O7 and a molecular weight of 769.90 g/mol. Its IUPAC name is benzyl N-[(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(1S)-1-(4-methoxyphenyl)ethyl]amino]pentanoyl]-N-phenylmethoxycarbonylcarbamate.
| Compound Name | benzyl N-[(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(1S)-1-(4-methoxyphenyl)ethyl]amino]pentanoyl]-N-phenylmethoxycarbonylcarbamate |
|---|---|
| PubChem CID | 57205788 |
| Molecular Formula | C45H47N5O7 |
| Molecular Weight | 769.90 g/mol |
| Exact Mass | 769.35 |
| IUPAC Name | benzyl N-[(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)-[(1S)-1-(4-methoxyphenyl)ethyl]amino]pentanoyl]-N-phenylmethoxycarbonylcarbamate |
| SMILES | COc1ccc([C@H](C)N(C(=O)C(c2ccccc2)c2ccccc2)[C@H](CCCN=C(N)N)C(=O)N(C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C45H47N5O7/c1-32(35-25-27-38(55-2)28-26-35)49(42(52)40(36-20-11-5-12-21-36)37-22-13-6-14-23-37)39(24-15-29-48-43(46)47)41(51)50(44(53)56-30-33-16-7-3-8-17-33)45(54)57-31-34-18-9-4-10-19-34/h3-14,16-23,25-28,32,39-40H,15,24,29-31H2,1-2H3,(H4,46,47,48)/t32-,39+/m0/s1 |
| InChIKey | AGOWVKVMKMLUMI-NXVGIJDASA-N |
| XLogP | 7.34 |
| TPSA | 166.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.90 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|