C47H48N4O8 — CID 57176025
(2R)-2-[[(S)-cyclopropyl-(4-methoxyphenyl)methyl]-(2,2-diphenylacetyl)amino]-5-(diaminomethylideneamino)-2,3-bis(phenylmethoxycarbonyl)pentanoic acid (PubChem CID 57176025) has the molecular formula C47H48N4O8 and a molecular weight of 796.92 g/mol. Its IUPAC name is (2R)-2-[[(S)-cyclopropyl-(4-methoxyphenyl)methyl]-(2,2-diphenylacetyl)amino]-5-(diaminomethylideneamino)-2,3-bis(phenylmethoxycarbonyl)pentanoic acid.
| Compound Name | (2R)-2-[[(S)-cyclopropyl-(4-methoxyphenyl)methyl]-(2,2-diphenylacetyl)amino]-5-(diaminomethylideneamino)-2,3-bis(phenylmethoxycarbonyl)pentanoic acid |
|---|---|
| PubChem CID | 57176025 |
| Molecular Formula | C47H48N4O8 |
| Molecular Weight | 796.92 g/mol |
| Exact Mass | 796.35 |
| IUPAC Name | (2R)-2-[[(S)-cyclopropyl-(4-methoxyphenyl)methyl]-(2,2-diphenylacetyl)amino]-5-(diaminomethylideneamino)-2,3-bis(phenylmethoxycarbonyl)pentanoic acid |
| SMILES | COc1ccc([C@H](C2CC2)N(C(=O)C(c2ccccc2)c2ccccc2)[C@](C(=O)O)(C(=O)OCc2ccccc2)C(CCN=C(N)N)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C47H48N4O8/c1-57-38-26-24-37(25-27-38)41(36-22-23-36)51(42(52)40(34-18-10-4-11-19-34)35-20-12-5-13-21-35)47(44(54)55,45(56)59-31-33-16-8-3-9-17-33)39(28-29-50-46(48)49)43(53)58-30-32-14-6-2-7-15-32/h2-21,24-27,36,39-41H,22-23,28-31H2,1H3,(H,54,55)(H4,48,49,50)/t39?,41-,47+/m0/s1 |
| InChIKey | FMHNCFJNNZHUND-MYVQYXHISA-N |
| XLogP | 6.40 |
| TPSA | 183.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.92 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|