C37H41N5O5 — CID 139896053
benzyl N-[(2R)-5-(diaminomethylideneamino)-1-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-1-oxopentan-2-yl]-N-(2,2-diphenylacetyl)carbamate (PubChem CID 139896053) has the molecular formula C37H41N5O5 and a molecular weight of 635.77 g/mol. Its IUPAC name is benzyl N-[(2R)-5-(diaminomethylideneamino)-1-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-1-oxopentan-2-yl]-N-(2,2-diphenylacetyl)carbamate.
| Compound Name | benzyl N-[(2R)-5-(diaminomethylideneamino)-1-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-1-oxopentan-2-yl]-N-(2,2-diphenylacetyl)carbamate |
|---|---|
| PubChem CID | 139896053 |
| Molecular Formula | C37H41N5O5 |
| Molecular Weight | 635.77 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | benzyl N-[(2R)-5-(diaminomethylideneamino)-1-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-1-oxopentan-2-yl]-N-(2,2-diphenylacetyl)carbamate |
| SMILES | COc1ccc([C@H](C)NC(=O)[C@@H](CCCN=C(N)N)N(C(=O)OCc2ccccc2)C(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H41N5O5/c1-26(28-20-22-31(46-2)23-21-28)41-34(43)32(19-12-24-40-36(38)39)42(37(45)47-25-27-13-6-3-7-14-27)35(44)33(29-15-8-4-9-16-29)30-17-10-5-11-18-30/h3-11,13-18,20-23,26,32-33H,12,19,24-25H2,1-2H3,(H,41,43)(H4,38,39,40)/t26-,32+/m0/s1 |
| InChIKey | UHRUKFWKERUYCM-XYFQYJLHSA-N |
| XLogP | 5.29 |
| TPSA | 149.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.77 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|