C37H39N3O6 — CID 57104835
(2R)-2-[[(1R)-1-[4-(2-amino-2-oxoethyl)phenyl]ethyl]-(2,2-diphenylacetyl)amino]-5-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 57104835) has the molecular formula C37H39N3O6 and a molecular weight of 621.73 g/mol. Its IUPAC name is (2R)-2-[[(1R)-1-[4-(2-amino-2-oxoethyl)phenyl]ethyl]-(2,2-diphenylacetyl)amino]-5-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (2R)-2-[[(1R)-1-[4-(2-amino-2-oxoethyl)phenyl]ethyl]-(2,2-diphenylacetyl)amino]-5-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 57104835 |
| Molecular Formula | C37H39N3O6 |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | (2R)-2-[[(1R)-1-[4-(2-amino-2-oxoethyl)phenyl]ethyl]-(2,2-diphenylacetyl)amino]-5-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | C[C@H](c1ccc(CC(N)=O)cc1)N(C(=O)C(c1ccccc1)c1ccccc1)[C@H](CCCNC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C37H39N3O6/c1-26(29-21-19-27(20-22-29)24-33(38)41)40(35(42)34(30-14-7-3-8-15-30)31-16-9-4-10-17-31)32(36(43)44)18-11-23-39-37(45)46-25-28-12-5-2-6-13-28/h2-10,12-17,19-22,26,32,34H,11,18,23-25H2,1H3,(H2,38,41)(H,39,45)(H,43,44)/t26-,32-/m1/s1 |
| InChIKey | KGXGYBCVCLAHHA-HVIPQOSHSA-N |
| XLogP | 5.60 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|