C33H34N4O5 — CID 54051974
benzyl N-[(4R)-5-amino-4-[[4-(2-amino-2-oxoethyl)phenyl]methyl-(naphthalene-2-carbonyl)amino]-5-oxopentyl]carbamate (PubChem CID 54051974) has the molecular formula C33H34N4O5 and a molecular weight of 566.66 g/mol. Its IUPAC name is benzyl N-[(4R)-5-amino-4-[[4-(2-amino-2-oxoethyl)phenyl]methyl-(naphthalene-2-carbonyl)amino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[(4R)-5-amino-4-[[4-(2-amino-2-oxoethyl)phenyl]methyl-(naphthalene-2-carbonyl)amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 54051974 |
| Molecular Formula | C33H34N4O5 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | benzyl N-[(4R)-5-amino-4-[[4-(2-amino-2-oxoethyl)phenyl]methyl-(naphthalene-2-carbonyl)amino]-5-oxopentyl]carbamate |
| SMILES | NC(=O)Cc1ccc(CN(C(=O)c2ccc3ccccc3c2)[C@H](CCCNC(=O)OCc2ccccc2)C(N)=O)cc1 |
| InChI | InChI=1S/C33H34N4O5/c34-30(38)19-23-12-14-24(15-13-23)21-37(32(40)28-17-16-26-9-4-5-10-27(26)20-28)29(31(35)39)11-6-18-36-33(41)42-22-25-7-2-1-3-8-25/h1-5,7-10,12-17,20,29H,6,11,18-19,21-22H2,(H2,34,38)(H2,35,39)(H,36,41)/t29-/m1/s1 |
| InChIKey | LTNMFXBUJRFFQI-GDLZYMKVSA-N |
| XLogP | 4.07 |
| TPSA | 144.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|