C37H44N4O5 — CID 90223888
benzyl N-[(2S)-1-amino-1-oxo-4-[6-[4-(phenylmethoxycarbonylamino)butyl]naphthalen-2-yl]butan-2-yl]-N-(3-aminopropyl)carbamate (PubChem CID 90223888) has the molecular formula C37H44N4O5 and a molecular weight of 624.78 g/mol. Its IUPAC name is benzyl N-[(2S)-1-amino-1-oxo-4-[6-[4-(phenylmethoxycarbonylamino)butyl]naphthalen-2-yl]butan-2-yl]-N-(3-aminopropyl)carbamate.
| Compound Name | benzyl N-[(2S)-1-amino-1-oxo-4-[6-[4-(phenylmethoxycarbonylamino)butyl]naphthalen-2-yl]butan-2-yl]-N-(3-aminopropyl)carbamate |
|---|---|
| PubChem CID | 90223888 |
| Molecular Formula | C37H44N4O5 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | benzyl N-[(2S)-1-amino-1-oxo-4-[6-[4-(phenylmethoxycarbonylamino)butyl]naphthalen-2-yl]butan-2-yl]-N-(3-aminopropyl)carbamate |
| SMILES | NCCCN(C(=O)OCc1ccccc1)[C@@H](CCc1ccc2cc(CCCCNC(=O)OCc3ccccc3)ccc2c1)C(N)=O |
| InChI | InChI=1S/C37H44N4O5/c38-21-9-23-41(37(44)46-27-31-13-5-2-6-14-31)34(35(39)42)20-17-29-16-19-32-24-28(15-18-33(32)25-29)10-7-8-22-40-36(43)45-26-30-11-3-1-4-12-30/h1-6,11-16,18-19,24-25,34H,7-10,17,20-23,26-27,38H2,(H2,39,42)(H,40,43)/t34-/m0/s1 |
| InChIKey | IVLMLFBZTHRCNJ-UMSFTDKQSA-N |
| XLogP | 5.86 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|