C35H40N6O5 — CID 57320434
benzyl N-[(4R)-5-amino-4-[2-[4-[(carbamoylamino)methyl]phenyl]ethyl-(naphthalen-2-ylmethylcarbamoyl)amino]-5-oxopentyl]carbamate (PubChem CID 57320434) has the molecular formula C35H40N6O5 and a molecular weight of 624.74 g/mol. Its IUPAC name is benzyl N-[(4R)-5-amino-4-[2-[4-[(carbamoylamino)methyl]phenyl]ethyl-(naphthalen-2-ylmethylcarbamoyl)amino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[(4R)-5-amino-4-[2-[4-[(carbamoylamino)methyl]phenyl]ethyl-(naphthalen-2-ylmethylcarbamoyl)amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 57320434 |
| Molecular Formula | C35H40N6O5 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | benzyl N-[(4R)-5-amino-4-[2-[4-[(carbamoylamino)methyl]phenyl]ethyl-(naphthalen-2-ylmethylcarbamoyl)amino]-5-oxopentyl]carbamate |
| SMILES | NC(=O)NCc1ccc(CCN(C(=O)NCc2ccc3ccccc3c2)[C@H](CCCNC(=O)OCc2ccccc2)C(N)=O)cc1 |
| InChI | InChI=1S/C35H40N6O5/c36-32(42)31(11-6-19-38-35(45)46-24-27-7-2-1-3-8-27)41(20-18-25-12-14-26(15-13-25)22-39-33(37)43)34(44)40-23-28-16-17-29-9-4-5-10-30(29)21-28/h1-5,7-10,12-17,21,31H,6,11,18-20,22-24H2,(H2,36,42)(H,38,45)(H,40,44)(H3,37,39,43)/t31-/m1/s1 |
| InChIKey | YXNJHGFOBUEYTC-WJOKGBTCSA-N |
| XLogP | 4.32 |
| TPSA | 168.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|