C25H29N3O3 — CID 57093072
benzyl N-[(4R)-5-amino-4-[[(1R)-1-naphthalen-2-ylethyl]amino]-5-oxopentyl]carbamate (PubChem CID 57093072) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is benzyl N-[(4R)-5-amino-4-[[(1R)-1-naphthalen-2-ylethyl]amino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[(4R)-5-amino-4-[[(1R)-1-naphthalen-2-ylethyl]amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 57093072 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | benzyl N-[(4R)-5-amino-4-[[(1R)-1-naphthalen-2-ylethyl]amino]-5-oxopentyl]carbamate |
| SMILES | C[C@@H](N[C@H](CCCNC(=O)OCc1ccccc1)C(N)=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H29N3O3/c1-18(21-14-13-20-10-5-6-11-22(20)16-21)28-23(24(26)29)12-7-15-27-25(30)31-17-19-8-3-2-4-9-19/h2-6,8-11,13-14,16,18,23,28H,7,12,15,17H2,1H3,(H2,26,29)(H,27,30)/t18-,23-/m1/s1 |
| InChIKey | FITBDTMZGGBRMM-WZONZLPQSA-N |
| XLogP | 4.05 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|