C45H47N5O8 — CID 70141797
benzyl N-[N'-[(4R)-5-amino-4-[[(1R)-1-(4-hydroxyphenyl)ethyl]-[2-[2-(4-methoxyphenyl)phenyl]acetyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate (PubChem CID 70141797) has the molecular formula C45H47N5O8 and a molecular weight of 785.90 g/mol. Its IUPAC name is benzyl N-[N'-[(4R)-5-amino-4-[[(1R)-1-(4-hydroxyphenyl)ethyl]-[2-[2-(4-methoxyphenyl)phenyl]acetyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | benzyl N-[N'-[(4R)-5-amino-4-[[(1R)-1-(4-hydroxyphenyl)ethyl]-[2-[2-(4-methoxyphenyl)phenyl]acetyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 70141797 |
| Molecular Formula | C45H47N5O8 |
| Molecular Weight | 785.90 g/mol |
| Exact Mass | 785.34 |
| IUPAC Name | benzyl N-[N'-[(4R)-5-amino-4-[[(1R)-1-(4-hydroxyphenyl)ethyl]-[2-[2-(4-methoxyphenyl)phenyl]acetyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
| SMILES | COc1ccc(-c2ccccc2CC(=O)N([C@H](CCCN=C(NC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)C(N)=O)[C@H](C)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C45H47N5O8/c1-31(34-19-23-37(51)24-20-34)50(41(52)28-36-16-9-10-17-39(36)35-21-25-38(56-2)26-22-35)40(42(46)53)18-11-27-47-43(48-44(54)57-29-32-12-5-3-6-13-32)49-45(55)58-30-33-14-7-4-8-15-33/h3-10,12-17,19-26,31,40,51H,11,18,27-30H2,1-2H3,(H2,46,53)(H2,47,48,49,54,55)/t31-,40-/m1/s1 |
| InChIKey | SEHSWANTCSZGDS-RDDZTUDVSA-N |
| XLogP | 7.04 |
| TPSA | 181.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.90 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|