C32H39N7O5 — CID 54514770
ethyl N-[[4-[[[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-(2,2-diphenylacetyl)amino]methyl]phenyl]methylcarbamoyl]carbamate (PubChem CID 54514770) has the molecular formula C32H39N7O5 and a molecular weight of 601.71 g/mol. Its IUPAC name is ethyl N-[[4-[[[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-(2,2-diphenylacetyl)amino]methyl]phenyl]methylcarbamoyl]carbamate.
| Compound Name | ethyl N-[[4-[[[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-(2,2-diphenylacetyl)amino]methyl]phenyl]methylcarbamoyl]carbamate |
|---|---|
| PubChem CID | 54514770 |
| Molecular Formula | C32H39N7O5 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | ethyl N-[[4-[[[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-(2,2-diphenylacetyl)amino]methyl]phenyl]methylcarbamoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)NCc1ccc(CN(C(=O)C(c2ccccc2)c2ccccc2)[C@H](CCCN=C(N)N)C(N)=O)cc1 |
| InChI | InChI=1S/C32H39N7O5/c1-2-44-32(43)38-31(42)37-20-22-15-17-23(18-16-22)21-39(26(28(33)40)14-9-19-36-30(34)35)29(41)27(24-10-5-3-6-11-24)25-12-7-4-8-13-25/h3-8,10-13,15-18,26-27H,2,9,14,19-21H2,1H3,(H2,33,40)(H4,34,35,36)(H2,37,38,42,43)/t26-/m1/s1 |
| InChIKey | YLQOMVMVWNBHRI-AREMUKBSSA-N |
| XLogP | 2.71 |
| TPSA | 195.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|