C31H36N6O4 — CID 54469316
N-[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-[2-(4-hydroxyphenyl)ethyl]-5-(2-phenylethoxy)-1H-indole-2-carboxamide (PubChem CID 54469316) has the molecular formula C31H36N6O4 and a molecular weight of 556.67 g/mol. Its IUPAC name is N-[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-[2-(4-hydroxyphenyl)ethyl]-5-(2-phenylethoxy)-1H-indole-2-carboxamide.
| Compound Name | N-[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-[2-(4-hydroxyphenyl)ethyl]-5-(2-phenylethoxy)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 54469316 |
| Molecular Formula | C31H36N6O4 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | N-[(2R)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-[2-(4-hydroxyphenyl)ethyl]-5-(2-phenylethoxy)-1H-indole-2-carboxamide |
| SMILES | NC(=O)[C@@H](CCCN=C(N)N)N(CCc1ccc(O)cc1)C(=O)c1cc2cc(OCCc3ccccc3)ccc2[nH]1 |
| InChI | InChI=1S/C31H36N6O4/c32-29(39)28(7-4-16-35-31(33)34)37(17-14-22-8-10-24(38)11-9-22)30(40)27-20-23-19-25(12-13-26(23)36-27)41-18-15-21-5-2-1-3-6-21/h1-3,5-6,8-13,19-20,28,36,38H,4,7,14-18H2,(H2,32,39)(H4,33,34,35)/t28-/m1/s1 |
| InChIKey | XHEGZXAGSRZCBG-MUUNZHRXSA-N |
| XLogP | 3.09 |
| TPSA | 173.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|