C27H32N4O2 — CID 10575302
4-(diaminomethylideneamino)-N-(2,2-diphenylethyl)-N-[2-(4-hydroxyphenyl)ethyl]butanamide (PubChem CID 10575302) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-N-(2,2-diphenylethyl)-N-[2-(4-hydroxyphenyl)ethyl]butanamide.
| Compound Name | 4-(diaminomethylideneamino)-N-(2,2-diphenylethyl)-N-[2-(4-hydroxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 10575302 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 4-(diaminomethylideneamino)-N-(2,2-diphenylethyl)-N-[2-(4-hydroxyphenyl)ethyl]butanamide |
| SMILES | NC(N)=NCCCC(=O)N(CCc1ccc(O)cc1)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32N4O2/c28-27(29)30-18-7-12-26(33)31(19-17-21-13-15-24(32)16-14-21)20-25(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-6,8-11,13-16,25,32H,7,12,17-20H2,(H4,28,29,30) |
| InChIKey | CIDBZOLYDYVWMM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|