C26H28Cl2N6O4 — CID 54408344
2-[[(2R)-2-[(4-amino-3,5-dichlorophenyl)methyl-(naphthalene-2-carbonyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 54408344) has the molecular formula C26H28Cl2N6O4 and a molecular weight of 559.45 g/mol. Its IUPAC name is 2-[[(2R)-2-[(4-amino-3,5-dichlorophenyl)methyl-(naphthalene-2-carbonyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-2-[(4-amino-3,5-dichlorophenyl)methyl-(naphthalene-2-carbonyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 54408344 |
| Molecular Formula | C26H28Cl2N6O4 |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 2-[[(2R)-2-[(4-amino-3,5-dichlorophenyl)methyl-(naphthalene-2-carbonyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | NC(N)=NCCC[C@H](C(=O)NCC(=O)O)N(Cc1cc(Cl)c(N)c(Cl)c1)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H28Cl2N6O4/c27-19-10-15(11-20(28)23(19)29)14-34(25(38)18-8-7-16-4-1-2-5-17(16)12-18)21(6-3-9-32-26(30)31)24(37)33-13-22(35)36/h1-2,4-5,7-8,10-12,21H,3,6,9,13-14,29H2,(H,33,37)(H,35,36)(H4,30,31,32)/t21-/m1/s1 |
| InChIKey | VSINNGYSQZXKKC-OAQYLSRUSA-N |
| XLogP | 2.99 |
| TPSA | 177.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|