C19H23Cl4N7O3S — CID 67792199
(2R)-2-amino-N-[(4-amino-3,5-dichlorophenyl)methyl]-N-(4-amino-3,5-dichlorophenyl)sulfonyl-5-(diaminomethylideneamino)pentanamide (PubChem CID 67792199) has the molecular formula C19H23Cl4N7O3S and a molecular weight of 571.32 g/mol. Its IUPAC name is (2R)-2-amino-N-[(4-amino-3,5-dichlorophenyl)methyl]-N-(4-amino-3,5-dichlorophenyl)sulfonyl-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2R)-2-amino-N-[(4-amino-3,5-dichlorophenyl)methyl]-N-(4-amino-3,5-dichlorophenyl)sulfonyl-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 67792199 |
| Molecular Formula | C19H23Cl4N7O3S |
| Molecular Weight | 571.32 g/mol |
| Exact Mass | 569.03 |
| IUPAC Name | (2R)-2-amino-N-[(4-amino-3,5-dichlorophenyl)methyl]-N-(4-amino-3,5-dichlorophenyl)sulfonyl-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(N)=NCCC[C@@H](N)C(=O)N(Cc1cc(Cl)c(N)c(Cl)c1)S(=O)(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C19H23Cl4N7O3S/c20-11-4-9(5-12(21)16(11)25)8-30(18(31)15(24)2-1-3-29-19(27)28)34(32,33)10-6-13(22)17(26)14(23)7-10/h4-7,15H,1-3,8,24-26H2,(H4,27,28,29)/t15-/m1/s1 |
| InChIKey | PWNONDSGNMLODR-OAHLLOKOSA-N |
| XLogP | 2.56 |
| TPSA | 196.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|