C6H13ClN4OZn — CID 160575007
(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl chloride;zinc (PubChem CID 160575007) has the molecular formula C6H13ClN4OZn and a molecular weight of 258.04 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl chloride;zinc.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl chloride;zinc |
|---|---|
| PubChem CID | 160575007 |
| Molecular Formula | C6H13ClN4OZn |
| Molecular Weight | 258.04 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl chloride;zinc |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)Cl.[Zn] |
| InChI | InChI=1S/C6H13ClN4O.Zn/c7-5(12)4(8)2-1-3-11-6(9)10;/h4H,1-3,8H2,(H4,9,10,11);/t4-;/m0./s1 |
| InChIKey | RBAKTGBUILSWDP-WCCKRBBISA-N |
| XLogP | -0.87 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.04 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|