C15H28Cl2N8O3 — CID 54217718
2-[(4S,10S)-4,10-diamino-6,8-dichloro-13-(diaminomethylideneamino)-5,7,9-trioxotridecyl]guanidine (PubChem CID 54217718) has the molecular formula C15H28Cl2N8O3 and a molecular weight of 439.35 g/mol. Its IUPAC name is 2-[(4S,10S)-4,10-diamino-6,8-dichloro-13-(diaminomethylideneamino)-5,7,9-trioxotridecyl]guanidine.
| Compound Name | 2-[(4S,10S)-4,10-diamino-6,8-dichloro-13-(diaminomethylideneamino)-5,7,9-trioxotridecyl]guanidine |
|---|---|
| PubChem CID | 54217718 |
| Molecular Formula | C15H28Cl2N8O3 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-[(4S,10S)-4,10-diamino-6,8-dichloro-13-(diaminomethylideneamino)-5,7,9-trioxotridecyl]guanidine |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)C(Cl)C(=O)C(Cl)C(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C15H28Cl2N8O3/c16-9(11(26)7(18)3-1-5-24-14(20)21)13(28)10(17)12(27)8(19)4-2-6-25-15(22)23/h7-10H,1-6,18-19H2,(H4,20,21,24)(H4,22,23,25)/t7-,8-,9?,10?/m0/s1 |
| InChIKey | QAJHVCNBGLMIBK-DKEVHCRPSA-N |
| XLogP | -2.33 |
| TPSA | 232.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|