C17H21ClN6O5S — CID 87293313
(2R)-2-amino-N-[[6-(4-chlorophenoxy)-3-pyridinyl]sulfonyl]-5-(diaminomethylideneamino)-N-hydroxypentanamide (PubChem CID 87293313) has the molecular formula C17H21ClN6O5S and a molecular weight of 456.91 g/mol. Its IUPAC name is (2R)-2-amino-N-[[6-(4-chlorophenoxy)-3-pyridinyl]sulfonyl]-5-(diaminomethylideneamino)-N-hydroxypentanamide.
| Compound Name | (2R)-2-amino-N-[[6-(4-chlorophenoxy)-3-pyridinyl]sulfonyl]-5-(diaminomethylideneamino)-N-hydroxypentanamide |
|---|---|
| PubChem CID | 87293313 |
| Molecular Formula | C17H21ClN6O5S |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (2R)-2-amino-N-[[6-(4-chlorophenoxy)-3-pyridinyl]sulfonyl]-5-(diaminomethylideneamino)-N-hydroxypentanamide |
| SMILES | NC(N)=NCCC[C@@H](N)C(=O)N(O)S(=O)(=O)c1ccc(Oc2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C17H21ClN6O5S/c18-11-3-5-12(6-4-11)29-15-8-7-13(10-23-15)30(27,28)24(26)16(25)14(19)2-1-9-22-17(20)21/h3-8,10,14,26H,1-2,9,19H2,(H4,20,21,22)/t14-/m1/s1 |
| InChIKey | CEFYIQQMBCLOEI-CQSZACIVSA-N |
| XLogP | 0.81 |
| TPSA | 187.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|