C22H26ClF2N3O6S — CID 87293460
(2R)-2-amino-N-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-6-morpholin-4-ylhexanamide (PubChem CID 87293460) has the molecular formula C22H26ClF2N3O6S and a molecular weight of 533.98 g/mol. Its IUPAC name is (2R)-2-amino-N-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-6-morpholin-4-ylhexanamide.
| Compound Name | (2R)-2-amino-N-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-6-morpholin-4-ylhexanamide |
|---|---|
| PubChem CID | 87293460 |
| Molecular Formula | C22H26ClF2N3O6S |
| Molecular Weight | 533.98 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | (2R)-2-amino-N-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-6-morpholin-4-ylhexanamide |
| SMILES | N[C@H](CCCCN1CCOCC1)C(=O)N(O)S(=O)(=O)c1cc(F)c(Oc2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C22H26ClF2N3O6S/c23-15-4-6-16(7-5-15)34-21-18(24)13-17(14-19(21)25)35(31,32)28(30)22(29)20(26)3-1-2-8-27-9-11-33-12-10-27/h4-7,13-14,20,30H,1-3,8-12,26H2/t20-/m1/s1 |
| InChIKey | OEGGVTPNQIEVQR-HXUWFJFHSA-N |
| XLogP | 3.15 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.98 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|