C19H22ClF2N3O7S2 — CID 123618506
2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-[ethyl(methylsulfonyl)amino]ethyl]amino]-N-hydroxyacetamide (PubChem CID 123618506) has the molecular formula C19H22ClF2N3O7S2 and a molecular weight of 541.98 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-[ethyl(methylsulfonyl)amino]ethyl]amino]-N-hydroxyacetamide.
| Compound Name | 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-[ethyl(methylsulfonyl)amino]ethyl]amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 123618506 |
| Molecular Formula | C19H22ClF2N3O7S2 |
| Molecular Weight | 541.98 g/mol |
| Exact Mass | 541.06 |
| IUPAC Name | 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-[ethyl(methylsulfonyl)amino]ethyl]amino]-N-hydroxyacetamide |
| SMILES | CCN(CCN(CC(=O)NO)S(=O)(=O)c1cc(F)c(Oc2ccc(Cl)cc2)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H22ClF2N3O7S2/c1-3-24(33(2,28)29)8-9-25(12-18(26)23-27)34(30,31)15-10-16(21)19(17(22)11-15)32-14-6-4-13(20)5-7-14/h4-7,10-11,27H,3,8-9,12H2,1-2H3,(H,23,26) |
| InChIKey | QUHKEMWUDLRNDQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.98 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|