C23H29F2N3O8S — CID 123152540
2-methoxyethyl N-[2-[(3,5-difluoro-4-phenoxyphenyl)sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-propylcarbamate (PubChem CID 123152540) has the molecular formula C23H29F2N3O8S and a molecular weight of 545.56 g/mol. Its IUPAC name is 2-methoxyethyl N-[2-[(3,5-difluoro-4-phenoxyphenyl)sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-propylcarbamate.
| Compound Name | 2-methoxyethyl N-[2-[(3,5-difluoro-4-phenoxyphenyl)sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 123152540 |
| Molecular Formula | C23H29F2N3O8S |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 2-methoxyethyl N-[2-[(3,5-difluoro-4-phenoxyphenyl)sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CCN(CC(=O)NO)S(=O)(=O)c1cc(F)c(Oc2ccccc2)c(F)c1)C(=O)OCCOC |
| InChI | InChI=1S/C23H29F2N3O8S/c1-3-9-27(23(30)35-13-12-34-2)10-11-28(16-21(29)26-31)37(32,33)18-14-19(24)22(20(25)15-18)36-17-7-5-4-6-8-17/h4-8,14-15,31H,3,9-13,16H2,1-2H3,(H,26,29) |
| InChIKey | JFFDCTPZAIWSBR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|