C19H24N4O4S — CID 142683259
N-hydroxy-2-[pentyl-(4-phenyldiazenylphenyl)sulfonylamino]acetamide (PubChem CID 142683259) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-hydroxy-2-[pentyl-(4-phenyldiazenylphenyl)sulfonylamino]acetamide.
| Compound Name | N-hydroxy-2-[pentyl-(4-phenyldiazenylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 142683259 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-hydroxy-2-[pentyl-(4-phenyldiazenylphenyl)sulfonylamino]acetamide |
| SMILES | CCCCCN(CC(=O)NO)S(=O)(=O)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N4O4S/c1-2-3-7-14-23(15-19(24)22-25)28(26,27)18-12-10-17(11-13-18)21-20-16-8-5-4-6-9-16/h4-6,8-13,25H,2-3,7,14-15H2,1H3,(H,22,24)/b21-20+ |
| InChIKey | GRKUWBQYPAWDHL-QZQOTICOSA-N |
| XLogP | 3.79 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|