C18H24N2O4S — CID 143926016
2-[hexyl(naphthalen-2-ylsulfonyl)amino]-N-hydroxyacetamide (PubChem CID 143926016) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-[hexyl(naphthalen-2-ylsulfonyl)amino]-N-hydroxyacetamide.
| Compound Name | 2-[hexyl(naphthalen-2-ylsulfonyl)amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 143926016 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-[hexyl(naphthalen-2-ylsulfonyl)amino]-N-hydroxyacetamide |
| SMILES | CCCCCCN(CC(=O)NO)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H24N2O4S/c1-2-3-4-7-12-20(14-18(21)19-22)25(23,24)17-11-10-15-8-5-6-9-16(15)13-17/h5-6,8-11,13,22H,2-4,7,12,14H2,1H3,(H,19,21) |
| InChIKey | GMRKFRQVOVATCY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|