C19H26N2O3S — CID 92518793
2-[ethyl(naphthalen-2-ylsulfonyl)amino]-N-[(2S)-pentan-2-yl]acetamide (PubChem CID 92518793) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-[ethyl(naphthalen-2-ylsulfonyl)amino]-N-[(2S)-pentan-2-yl]acetamide.
| Compound Name | 2-[ethyl(naphthalen-2-ylsulfonyl)amino]-N-[(2S)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 92518793 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-[ethyl(naphthalen-2-ylsulfonyl)amino]-N-[(2S)-pentan-2-yl]acetamide |
| SMILES | CCC[C@H](C)NC(=O)CN(CC)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H26N2O3S/c1-4-8-15(3)20-19(22)14-21(5-2)25(23,24)18-12-11-16-9-6-7-10-17(16)13-18/h6-7,9-13,15H,4-5,8,14H2,1-3H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | FSLICXUAHIQDGX-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |