C21H25ClF2N4O6S — CID 123280311
2-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl-ethylamino]-N-methylacetamide (PubChem CID 123280311) has the molecular formula C21H25ClF2N4O6S and a molecular weight of 534.97 g/mol. Its IUPAC name is 2-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl-ethylamino]-N-methylacetamide.
| Compound Name | 2-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl-ethylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 123280311 |
| Molecular Formula | C21H25ClF2N4O6S |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 2-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl-ethylamino]-N-methylacetamide |
| SMILES | CCN(CCN(CC(=O)NO)S(=O)(=O)c1cc(F)c(Oc2ccc(Cl)cc2)c(F)c1)CC(=O)NC |
| InChI | InChI=1S/C21H25ClF2N4O6S/c1-3-27(12-19(29)25-2)8-9-28(13-20(30)26-31)35(32,33)16-10-17(23)21(18(24)11-16)34-15-6-4-14(22)5-7-15/h4-7,10-11,31H,3,8-9,12-13H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | XBGIQNRXLQNJIH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|