C27H28ClF2N3O7S — CID 123657788
benzyl N-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-propylcarbamate (PubChem CID 123657788) has the molecular formula C27H28ClF2N3O7S and a molecular weight of 612.05 g/mol. Its IUPAC name is benzyl N-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-propylcarbamate.
| Compound Name | benzyl N-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 123657788 |
| Molecular Formula | C27H28ClF2N3O7S |
| Molecular Weight | 612.05 g/mol |
| Exact Mass | 611.13 |
| IUPAC Name | benzyl N-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CCN(CC(=O)NO)S(=O)(=O)c1cc(F)c(Oc2ccc(Cl)cc2)c(F)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H28ClF2N3O7S/c1-2-12-32(27(35)39-18-19-6-4-3-5-7-19)13-14-33(17-25(34)31-36)41(37,38)22-15-23(29)26(24(30)16-22)40-21-10-8-20(28)9-11-21/h3-11,15-16,36H,2,12-14,17-18H2,1H3,(H,31,34) |
| InChIKey | WKFCUTCOGMKKSM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.05 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|