C20H22ClF2N3O6S — CID 10074901
(2S)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-4-(2-methoxyethyl)piperazine-2-carboxamide (PubChem CID 10074901) has the molecular formula C20H22ClF2N3O6S and a molecular weight of 505.93 g/mol. Its IUPAC name is (2S)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-4-(2-methoxyethyl)piperazine-2-carboxamide.
| Compound Name | (2S)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-4-(2-methoxyethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 10074901 |
| Molecular Formula | C20H22ClF2N3O6S |
| Molecular Weight | 505.93 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | (2S)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-4-(2-methoxyethyl)piperazine-2-carboxamide |
| SMILES | COCCN1CCN(S(=O)(=O)c2cc(F)c(Oc3ccc(Cl)cc3)c(F)c2)[C@H](C(=O)NO)C1 |
| InChI | InChI=1S/C20H22ClF2N3O6S/c1-31-9-8-25-6-7-26(18(12-25)20(27)24-28)33(29,30)15-10-16(22)19(17(23)11-15)32-14-4-2-13(21)3-5-14/h2-5,10-11,18,28H,6-9,12H2,1H3,(H,24,27)/t18-/m0/s1 |
| InChIKey | DUCXAIRGKULCOC-SFHVURJKSA-N |
| XLogP | 2.24 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.93 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|