C21H22ClF2N3O6S — CID 58215067
(2R)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-4-(2-oxobutyl)piperazine-2-carboxamide (PubChem CID 58215067) has the molecular formula C21H22ClF2N3O6S and a molecular weight of 517.94 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-4-(2-oxobutyl)piperazine-2-carboxamide.
| Compound Name | (2R)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-4-(2-oxobutyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 58215067 |
| Molecular Formula | C21H22ClF2N3O6S |
| Molecular Weight | 517.94 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | (2R)-1-[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-N-hydroxy-4-(2-oxobutyl)piperazine-2-carboxamide |
| SMILES | CCC(=O)CN1CCN(S(=O)(=O)c2cc(F)c(Oc3ccc(Cl)cc3)c(F)c2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C21H22ClF2N3O6S/c1-2-14(28)11-26-7-8-27(19(12-26)21(29)25-30)34(31,32)16-9-17(23)20(18(24)10-16)33-15-5-3-13(22)4-6-15/h3-6,9-10,19,30H,2,7-8,11-12H2,1H3,(H,25,29)/t19-/m1/s1 |
| InChIKey | PARUDUKAFWRDKW-LJQANCHMSA-N |
| XLogP | 2.57 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.94 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|