C13H17F2N3O5S — CID 59294698
(2R)-1-(3,5-difluoro-4-methoxyphenyl)sulfonyl-N-hydroxy-4-methylpiperazine-2-carboxamide (PubChem CID 59294698) has the molecular formula C13H17F2N3O5S and a molecular weight of 365.36 g/mol. Its IUPAC name is (2R)-1-(3,5-difluoro-4-methoxyphenyl)sulfonyl-N-hydroxy-4-methylpiperazine-2-carboxamide.
| Compound Name | (2R)-1-(3,5-difluoro-4-methoxyphenyl)sulfonyl-N-hydroxy-4-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 59294698 |
| Molecular Formula | C13H17F2N3O5S |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (2R)-1-(3,5-difluoro-4-methoxyphenyl)sulfonyl-N-hydroxy-4-methylpiperazine-2-carboxamide |
| SMILES | COc1c(F)cc(S(=O)(=O)N2CCN(C)C[C@@H]2C(=O)NO)cc1F |
| InChI | InChI=1S/C13H17F2N3O5S/c1-17-3-4-18(11(7-17)13(19)16-20)24(21,22)8-5-9(14)12(23-2)10(15)6-8/h5-6,11,20H,3-4,7H2,1-2H3,(H,16,19)/t11-/m1/s1 |
| InChIKey | WLOPRVOJHWXTPO-LLVKDONJSA-N |
| XLogP | -0.22 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|