C17H20FN3O7S3 — CID 54303971
(2R)-1-[5-(3-fluoro-4-methoxyphenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide (PubChem CID 54303971) has the molecular formula C17H20FN3O7S3 and a molecular weight of 493.56 g/mol. Its IUPAC name is (2R)-1-[5-(3-fluoro-4-methoxyphenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide.
| Compound Name | (2R)-1-[5-(3-fluoro-4-methoxyphenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 54303971 |
| Molecular Formula | C17H20FN3O7S3 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | (2R)-1-[5-(3-fluoro-4-methoxyphenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)N3CCN(S(C)(=O)=O)C[C@@H]3C(=O)NO)s2)cc1F |
| InChI | InChI=1S/C17H20FN3O7S3/c1-28-14-4-3-11(9-12(14)18)15-5-6-16(29-15)31(26,27)21-8-7-20(30(2,24)25)10-13(21)17(22)19-23/h3-6,9,13,23H,7-8,10H2,1-2H3,(H,19,22)/t13-/m1/s1 |
| InChIKey | SGEMEICCTMSMGR-CYBMUJFWSA-N |
| XLogP | 0.70 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|