C16H19FN3NaO6S3 — CID 173236124
sodium;(2R)-1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide;hydride (PubChem CID 173236124) has the molecular formula C16H19FN3NaO6S3 and a molecular weight of 487.53 g/mol. Its IUPAC name is sodium;(2R)-1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide;hydride.
| Compound Name | sodium;(2R)-1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide;hydride |
|---|---|
| PubChem CID | 173236124 |
| Molecular Formula | C16H19FN3NaO6S3 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | sodium;(2R)-1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide;hydride |
| SMILES | CS(=O)(=O)N1CCN(S(=O)(=O)c2ccc(-c3ccc(F)cc3)s2)[C@@H](C(=O)NO)C1.[H-].[Na+] |
| InChI | InChI=1S/C16H18FN3O6S3.Na.H/c1-28(23,24)19-8-9-20(13(10-19)16(21)18-22)29(25,26)15-7-6-14(27-15)11-2-4-12(17)5-3-11;;/h2-7,13,22H,8-10H2,1H3,(H,18,21);;/q;+1;-1/t13-;;/m1../s1 |
| InChIKey | QOOVVIULGNQTJR-FFXKMJQXSA-N |
| XLogP | -2.19 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|