C16H18FN3O6S3 — CID 18387690
1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide (PubChem CID 18387690) has the molecular formula C16H18FN3O6S3 and a molecular weight of 463.53 g/mol. Its IUPAC name is 1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide.
| Compound Name | 1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 18387690 |
| Molecular Formula | C16H18FN3O6S3 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-hydroxy-4-methylsulfonylpiperazine-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCN(S(=O)(=O)c2ccc(-c3ccc(F)cc3)s2)C(C(=O)NO)C1 |
| InChI | InChI=1S/C16H18FN3O6S3/c1-28(23,24)19-8-9-20(13(10-19)16(21)18-22)29(25,26)15-7-6-14(27-15)11-2-4-12(17)5-3-11/h2-7,13,22H,8-10H2,1H3,(H,18,21) |
| InChIKey | YFWUVSPVKPCLSA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|