C24H31N3O9S3 — CID 22901471
[4-[5-[(2R)-4-methylsulfonyl-2-(oxan-2-yloxycarbamoyl)piperazin-1-yl]sulfonylthiophen-2-yl]phenyl]methyl acetate (PubChem CID 22901471) has the molecular formula C24H31N3O9S3 and a molecular weight of 601.73 g/mol. Its IUPAC name is [4-[5-[(2R)-4-methylsulfonyl-2-(oxan-2-yloxycarbamoyl)piperazin-1-yl]sulfonylthiophen-2-yl]phenyl]methyl acetate.
| Compound Name | [4-[5-[(2R)-4-methylsulfonyl-2-(oxan-2-yloxycarbamoyl)piperazin-1-yl]sulfonylthiophen-2-yl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 22901471 |
| Molecular Formula | C24H31N3O9S3 |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | [4-[5-[(2R)-4-methylsulfonyl-2-(oxan-2-yloxycarbamoyl)piperazin-1-yl]sulfonylthiophen-2-yl]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(-c2ccc(S(=O)(=O)N3CCN(S(C)(=O)=O)C[C@@H]3C(=O)NOC3CCCCO3)s2)cc1 |
| InChI | InChI=1S/C24H31N3O9S3/c1-17(28)35-16-18-6-8-19(9-7-18)21-10-11-23(37-21)39(32,33)27-13-12-26(38(2,30)31)15-20(27)24(29)25-36-22-5-3-4-14-34-22/h6-11,20,22H,3-5,12-16H2,1-2H3,(H,25,29)/t20-,22?/m1/s1 |
| InChIKey | ONWKRWBGOXGPEL-PSDZMVHGSA-N |
| XLogP | 1.69 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|