C26H32ClN5O7S4 — CID 22901472
(2R)-1-[5-(4-chlorophenyl)thiophen-2-yl]sulfonyl-4-[3-(1H-imidazol-2-yl)-2-sulfanylpropyl]sulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide (PubChem CID 22901472) has the molecular formula C26H32ClN5O7S4 and a molecular weight of 690.29 g/mol. Its IUPAC name is (2R)-1-[5-(4-chlorophenyl)thiophen-2-yl]sulfonyl-4-[3-(1H-imidazol-2-yl)-2-sulfanylpropyl]sulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide.
| Compound Name | (2R)-1-[5-(4-chlorophenyl)thiophen-2-yl]sulfonyl-4-[3-(1H-imidazol-2-yl)-2-sulfanylpropyl]sulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 22901472 |
| Molecular Formula | C26H32ClN5O7S4 |
| Molecular Weight | 690.29 g/mol |
| Exact Mass | 689.09 |
| IUPAC Name | (2R)-1-[5-(4-chlorophenyl)thiophen-2-yl]sulfonyl-4-[3-(1H-imidazol-2-yl)-2-sulfanylpropyl]sulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide |
| SMILES | O=C(NOC1CCCCO1)[C@H]1CN(S(=O)(=O)CC(S)Cc2ncc[nH]2)CCN1S(=O)(=O)c1ccc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C26H32ClN5O7S4/c27-19-6-4-18(5-7-19)22-8-9-25(41-22)43(36,37)32-13-12-31(42(34,35)17-20(40)15-23-28-10-11-29-23)16-21(32)26(33)30-39-24-3-1-2-14-38-24/h4-11,20-21,24,40H,1-3,12-17H2,(H,28,29)(H,30,33)/t20?,21-,24?/m1/s1 |
| InChIKey | ZXFBPTXWJRZHNP-ZPGVXSSASA-N |
| XLogP | 2.91 |
| TPSA | 151.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|