C24H30FN3O6S2 — CID 54549013
(2R)-4-butanoyl-1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide (PubChem CID 54549013) has the molecular formula C24H30FN3O6S2 and a molecular weight of 539.65 g/mol. Its IUPAC name is (2R)-4-butanoyl-1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide.
| Compound Name | (2R)-4-butanoyl-1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 54549013 |
| Molecular Formula | C24H30FN3O6S2 |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | (2R)-4-butanoyl-1-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide |
| SMILES | CCCC(=O)N1CCN(S(=O)(=O)c2ccc(-c3ccc(F)cc3)s2)[C@@H](C(=O)NOC2CCCCO2)C1 |
| InChI | InChI=1S/C24H30FN3O6S2/c1-2-5-21(29)27-13-14-28(19(16-27)24(30)26-34-22-6-3-4-15-33-22)36(31,32)23-12-11-20(35-23)17-7-9-18(25)10-8-17/h7-12,19,22H,2-6,13-16H2,1H3,(H,26,30)/t19-,22?/m1/s1 |
| InChIKey | ZIPCFDQHCKALGE-LCQOSCCDSA-N |
| XLogP | 3.13 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|