C25H31FN4O8S2 — CID 18387686
ethyl 2-[[4-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-3-(oxan-2-yloxycarbamoyl)piperazine-1-carbonyl]amino]acetate (PubChem CID 18387686) has the molecular formula C25H31FN4O8S2 and a molecular weight of 598.68 g/mol. Its IUPAC name is ethyl 2-[[4-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-3-(oxan-2-yloxycarbamoyl)piperazine-1-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[4-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-3-(oxan-2-yloxycarbamoyl)piperazine-1-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 18387686 |
| Molecular Formula | C25H31FN4O8S2 |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | ethyl 2-[[4-[5-(4-fluorophenyl)thiophen-2-yl]sulfonyl-3-(oxan-2-yloxycarbamoyl)piperazine-1-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N1CCN(S(=O)(=O)c2ccc(-c3ccc(F)cc3)s2)C(C(=O)NOC2CCCCO2)C1 |
| InChI | InChI=1S/C25H31FN4O8S2/c1-2-36-21(31)15-27-25(33)29-12-13-30(19(16-29)24(32)28-38-22-5-3-4-14-37-22)40(34,35)23-11-10-20(39-23)17-6-8-18(26)9-7-17/h6-11,19,22H,2-5,12-16H2,1H3,(H,27,33)(H,28,32) |
| InChIKey | KAWHTKAXNYRSBC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|