C21H27N3O7S3 — CID 18387553
4-methylsulfonyl-N-(oxan-2-yloxy)-1-(4-thiophen-2-ylphenyl)sulfonylpiperazine-2-carboxamide (PubChem CID 18387553) has the molecular formula C21H27N3O7S3 and a molecular weight of 529.66 g/mol. Its IUPAC name is 4-methylsulfonyl-N-(oxan-2-yloxy)-1-(4-thiophen-2-ylphenyl)sulfonylpiperazine-2-carboxamide.
| Compound Name | 4-methylsulfonyl-N-(oxan-2-yloxy)-1-(4-thiophen-2-ylphenyl)sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 18387553 |
| Molecular Formula | C21H27N3O7S3 |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 4-methylsulfonyl-N-(oxan-2-yloxy)-1-(4-thiophen-2-ylphenyl)sulfonylpiperazine-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCN(S(=O)(=O)c2ccc(-c3cccs3)cc2)C(C(=O)NOC2CCCCO2)C1 |
| InChI | InChI=1S/C21H27N3O7S3/c1-33(26,27)23-11-12-24(18(15-23)21(25)22-31-20-6-2-3-13-30-20)34(28,29)17-9-7-16(8-10-17)19-5-4-14-32-19/h4-5,7-10,14,18,20H,2-3,6,11-13,15H2,1H3,(H,22,25) |
| InChIKey | FZFMANZSWTYOCP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|