C22H29N3O8S3 — CID 54522637
(2R)-1-[5-(4-methoxyphenyl)thiophen-2-yl]sulfonyl-4-methylsulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide (PubChem CID 54522637) has the molecular formula C22H29N3O8S3 and a molecular weight of 559.69 g/mol. Its IUPAC name is (2R)-1-[5-(4-methoxyphenyl)thiophen-2-yl]sulfonyl-4-methylsulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide.
| Compound Name | (2R)-1-[5-(4-methoxyphenyl)thiophen-2-yl]sulfonyl-4-methylsulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 54522637 |
| Molecular Formula | C22H29N3O8S3 |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | (2R)-1-[5-(4-methoxyphenyl)thiophen-2-yl]sulfonyl-4-methylsulfonyl-N-(oxan-2-yloxy)piperazine-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)N3CCN(S(C)(=O)=O)C[C@@H]3C(=O)NOC3CCCCO3)s2)cc1 |
| InChI | InChI=1S/C22H29N3O8S3/c1-31-17-8-6-16(7-9-17)19-10-11-21(34-19)36(29,30)25-13-12-24(35(2,27)28)15-18(25)22(26)23-33-20-5-3-4-14-32-20/h6-11,18,20H,3-5,12-15H2,1-2H3,(H,23,26)/t18-,20?/m1/s1 |
| InChIKey | YQXMJVPHCJMZPS-QSVWIEALSA-N |
| XLogP | 1.63 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|