C19H26N4O6S3 — CID 54338095
(2R)-N-hydroxy-4-[methyl(propyl)sulfamoyl]-1-(5-phenylthiophen-2-yl)sulfonylpiperazine-2-carboxamide (PubChem CID 54338095) has the molecular formula C19H26N4O6S3 and a molecular weight of 502.64 g/mol. Its IUPAC name is (2R)-N-hydroxy-4-[methyl(propyl)sulfamoyl]-1-(5-phenylthiophen-2-yl)sulfonylpiperazine-2-carboxamide.
| Compound Name | (2R)-N-hydroxy-4-[methyl(propyl)sulfamoyl]-1-(5-phenylthiophen-2-yl)sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 54338095 |
| Molecular Formula | C19H26N4O6S3 |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | (2R)-N-hydroxy-4-[methyl(propyl)sulfamoyl]-1-(5-phenylthiophen-2-yl)sulfonylpiperazine-2-carboxamide |
| SMILES | CCCN(C)S(=O)(=O)N1CCN(S(=O)(=O)c2ccc(-c3ccccc3)s2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C19H26N4O6S3/c1-3-11-21(2)32(28,29)22-12-13-23(16(14-22)19(24)20-25)31(26,27)18-10-9-17(30-18)15-7-5-4-6-8-15/h4-10,16,25H,3,11-14H2,1-2H3,(H,20,24)/t16-/m1/s1 |
| InChIKey | TWYUBRRWBWBNJN-MRXNPFEDSA-N |
| XLogP | 1.18 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|