C25H29N3O3S2 — CID 53101357
N-[3-(N-methylanilino)propyl]-4-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide (PubChem CID 53101357) has the molecular formula C25H29N3O3S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is N-[3-(N-methylanilino)propyl]-4-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide.
| Compound Name | N-[3-(N-methylanilino)propyl]-4-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 53101357 |
| Molecular Formula | C25H29N3O3S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-[3-(N-methylanilino)propyl]-4-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide |
| SMILES | CN(CCCNC(=O)c1ccc(-c2ccc(S(=O)(=O)N3CCCC3)s2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H29N3O3S2/c1-27(22-8-3-2-4-9-22)17-7-16-26-25(29)21-12-10-20(11-13-21)23-14-15-24(32-23)33(30,31)28-18-5-6-19-28/h2-4,8-15H,5-7,16-19H2,1H3,(H,26,29) |
| InChIKey | HANCKHNCAKXTEV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|