C19H22N2O3S2 — CID 89238501
N-[[1-(5-phenylthiophen-2-yl)sulfonylpiperidin-4-yl]methyl]prop-2-enamide (PubChem CID 89238501) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[[1-(5-phenylthiophen-2-yl)sulfonylpiperidin-4-yl]methyl]prop-2-enamide.
| Compound Name | N-[[1-(5-phenylthiophen-2-yl)sulfonylpiperidin-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 89238501 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-[[1-(5-phenylthiophen-2-yl)sulfonylpiperidin-4-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC1CCN(S(=O)(=O)c2ccc(-c3ccccc3)s2)CC1 |
| InChI | InChI=1S/C19H22N2O3S2/c1-2-18(22)20-14-15-10-12-21(13-11-15)26(23,24)19-9-8-17(25-19)16-6-4-3-5-7-16/h2-9,15H,1,10-14H2,(H,20,22) |
| InChIKey | TXZAMFAVGODGIF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|