C24H24IN3O5S2 — CID 162661004
4-(4-iodophenyl)sulfonyl-N-methyl-1-(4-phenylphenyl)sulfonylpiperazine-2-carboxamide (PubChem CID 162661004) has the molecular formula C24H24IN3O5S2 and a molecular weight of 625.51 g/mol. Its IUPAC name is 4-(4-iodophenyl)sulfonyl-N-methyl-1-(4-phenylphenyl)sulfonylpiperazine-2-carboxamide.
| Compound Name | 4-(4-iodophenyl)sulfonyl-N-methyl-1-(4-phenylphenyl)sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 162661004 |
| Molecular Formula | C24H24IN3O5S2 |
| Molecular Weight | 625.51 g/mol |
| Exact Mass | 625.02 |
| IUPAC Name | 4-(4-iodophenyl)sulfonyl-N-methyl-1-(4-phenylphenyl)sulfonylpiperazine-2-carboxamide |
| SMILES | CNC(=O)C1CN(S(=O)(=O)c2ccc(I)cc2)CCN1S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24IN3O5S2/c1-26-24(29)23-17-27(34(30,31)21-13-9-20(25)10-14-21)15-16-28(23)35(32,33)22-11-7-19(8-12-22)18-5-3-2-4-6-18/h2-14,23H,15-17H2,1H3,(H,26,29) |
| InChIKey | JVFMEABEATUNSQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|