C24H24IN3O5S2 — CID 126116554
(2R)-1,4-bis(benzenesulfonyl)-N-(4-iodo-2-methylphenyl)piperazine-2-carboxamide (PubChem CID 126116554) has the molecular formula C24H24IN3O5S2 and a molecular weight of 625.51 g/mol. Its IUPAC name is (2R)-1,4-bis(benzenesulfonyl)-N-(4-iodo-2-methylphenyl)piperazine-2-carboxamide.
| Compound Name | (2R)-1,4-bis(benzenesulfonyl)-N-(4-iodo-2-methylphenyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 126116554 |
| Molecular Formula | C24H24IN3O5S2 |
| Molecular Weight | 625.51 g/mol |
| Exact Mass | 625.02 |
| IUPAC Name | (2R)-1,4-bis(benzenesulfonyl)-N-(4-iodo-2-methylphenyl)piperazine-2-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)[C@H]1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24IN3O5S2/c1-18-16-19(25)12-13-22(18)26-24(29)23-17-27(34(30,31)20-8-4-2-5-9-20)14-15-28(23)35(32,33)21-10-6-3-7-11-21/h2-13,16,23H,14-15,17H2,1H3,(H,26,29)/t23-/m1/s1 |
| InChIKey | UPVZIHFLLIEACB-HSZRJFAPSA-N |
| XLogP | 3.30 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|