C24H24N4O5S2 — CID 5018915
1,4-bis(benzenesulfonyl)-N-(benzylideneamino)piperazine-2-carboxamide (PubChem CID 5018915) has the molecular formula C24H24N4O5S2 and a molecular weight of 512.61 g/mol. Its IUPAC name is 1,4-bis(benzenesulfonyl)-N-(benzylideneamino)piperazine-2-carboxamide.
| Compound Name | 1,4-bis(benzenesulfonyl)-N-(benzylideneamino)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 5018915 |
| Molecular Formula | C24H24N4O5S2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 1,4-bis(benzenesulfonyl)-N-(benzylideneamino)piperazine-2-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1)C1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24N4O5S2/c29-24(26-25-18-20-10-4-1-5-11-20)23-19-27(34(30,31)21-12-6-2-7-13-21)16-17-28(23)35(32,33)22-14-8-3-9-15-22/h1-15,18,23H,16-17,19H2,(H,26,29) |
| InChIKey | RUPPDUURLBURNP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|